ChemNet > CAS > 134003-03-5 (1S,4R)-2-Azabicyclo[2.2.1]heptan-3-satu
134003-03-5 (1S,4R)-2-Azabicyclo[2.2.1]heptan-3-satu
Nama produk |
(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-satu |
Nama bahasa Inggris |
(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one; |
MF |
C6H9NO |
Berat Molekul |
111.1418 |
InChI |
InChI=1/C6H9NO/c8-6-4-1-2-5(3-4)7-6/h4-5H,1-3H2,(H,7,8)/t4-,5+/m1/s1 |
CAS NO |
134003-03-5 |
Struktur Molekul |
|
Kepadatan |
1.137g/cm3 |
Titik lebur |
76.2℃ |
Titik didih |
289.8°C at 760 mmHg |
Indeks bias |
1.509 |
Titik nyala |
160.9°C |
Tekanan uap |
0.00215mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|